Ammonium hexafluorophosphate
![]()
|
 Ball-and-stick model of the ammonium cation
|
 Ball-and-stick model of the hexafluorophosphate anion
|
|
| Names
|
| IUPAC name
ammonium hexafluorophosphate
|
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
| ECHA InfoCard
|
100.037.266 
|
| EC Number
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/F6P.H3N/c1-7(2,3,4,5)6;/h;1H3/q-1;/p+1  YKey: NIZXKAYXSNUDOU-UHFFFAOYSA-O YInChI=1/F6P.H3N/c1-7(2,3,4,5)6;/h;1H3/q-1;/p+1 Key: NIZXKAYXSNUDOU-IKLDFBCSAF
|
[NH4+].F[P-](F)(F)(F)(F)F F[P-](F)(F)(F)(F)F.[NH4+]
|
| Properties
|
|
|
(NH4)[PF6]
|
| Molar mass
|
163.00264
|
| Appearance
|
white solid
|
| Density
|
2.180 g/cm3
|
|
|
74.8 g/100 mL(20 °C)
|
| Hazards
|
| GHS labelling:
|
|
|
|
|
|
Danger
|
|
|
H314
|
|
|
P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, P501
|
| Safety data sheet (SDS)
|
Oxford MSDS
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Chemical compound
Ammonium hexafluorophosphate is the inorganic compound with the formula NH4PF6. It is a white water-soluble, hygroscopic solid. The compound is a salt consisting of the ammonium cation and hexafluorophosphate anion. It is commonly used as a source of the hexafluorophosphate anion, a weakly coordinating anion. It is prepared by combining neat ammonium fluoride and phosphorus pentachloride. Alternatively it can also be produced from phosphonitrilic chloride:[1]
- PCl5 + 6 NH4F → NH4PF6 + 5 NH4Cl
- PNCl2 + 6 HF → NH4PF6 + 2 HCl
References
- ^ W. Kwasnik (1963). "Ammonium Hexafluorophosphate (V)". In G. Brauer (ed.). Handbook of Preparative Inorganic Chemistry, 2nd Ed. Vol. 1. NY, NY: Academic Press. pp. 195–196.
