Lucifer yellow
![]()
|
| Names
|
Preferred IUPAC name
Dilithium 6-amino-2-(hydrazinecarbonyl)-1,3-dioxo-2,3-dihydro-1H-benzo[de]isoquinoline-5,8-disulfonate |
| Identifiers
|
|
|
|
|
|
|
| ChEBI
|
|
| ChEMBL
|
|
| ChemSpider
|
|
|
|
|
| UNII
|
|
|
|
|
InChI=1S/C13H10N4O9S2.2Li/c14-10-5-1-4(27(21,22)23)2-6-9(5)7(3-8(10)28(24,25)26)12(19)17(11(6)18)13(20)16-15;;/h1-3H,14-15H2,(H,16,20)(H,21,22,23)(H,24,25,26);;/q;2*+1/p-2  NKey: DLBFLQKQABVKGT-UHFFFAOYSA-L N
|
c1c(cc2c3c1c(c(cc3c(=O)n(c2=O)C(=O)NN)S(=O)(=O)[O-])N)S(=O)(=O)[O-].[Li+].[Li+]
|
| Properties
|
|
|
C13H10Li2N4O9S2
|
| Molar mass
|
444.24 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Chemical compound
Lucifer yellow is a fluorescent dye used in cell biology.[1] The key property of Lucifer yellow is that it can be readily visualized in both living and fixed cells using a fluorescence microscope. Lucifer yellow was invented by Walter W. Stewart at the National Institutes of Health and patented in 1978.[2]
Preparations
For common usage it is compounded with carbohydrazide (CH) and prepared as a lithium salt. The CH group allows it to be covalently linked to surrounding biomolecules during aldehyde fixation.[3]
Other cations such as ammonium or potassium can be used when lithium is undesirable, but the resulting salts are less soluble in water.
Lucifer yellow can also be compounded as a vinyl sulfone, with ethylenediamine, or with cadaverine. [clarification needed]
References
External links
